C16H30O — CID 71133313
(1S,7S,8S)-8-ethyl-3,4,5,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol (PubChem CID 71133313) has the molecular formula C16H30O and a molecular weight of 238.41 g/mol. Its IUPAC name is (1S,7S,8S)-8-ethyl-3,4,5,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol.
| Compound Name | (1S,7S,8S)-8-ethyl-3,4,5,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
|---|---|
| PubChem CID | 71133313 |
| Molecular Formula | C16H30O |
| Molecular Weight | 238.41 g/mol |
| Exact Mass | 238.23 |
| IUPAC Name | (1S,7S,8S)-8-ethyl-3,4,5,7-tetramethyl-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalen-1-ol |
| SMILES | CC[C@@H]1C2C(O)CC(C)C(C)C2C(C)C[C@@H]1C |
| InChI | InChI=1S/C16H30O/c1-6-13-10(3)7-11(4)15-12(5)9(2)8-14(17)16(13)15/h9-17H,6-8H2,1-5H3/t9?,10-,11?,12?,13-,14?,15?,16?/m0/s1 |
| InChIKey | OBFSPYJPEHOHKO-BDYMUVGRSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |