About 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline
2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline (PubChem CID 71133448) has the molecular formula C17H20N2OS
and a molecular weight of 300.43 g/mol. Its IUPAC name is 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline.
Molecular Properties
| Compound Name | 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline |
| PubChem CID | 71133448 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline |
| SMILES | CC1CC=C(c2nc3ccccc3nc2OC(C)(C)C)S1 |
| InChI | InChI=1S/C17H20N2OS/c1-11-9-10-14(21-11)15-16(20-17(2,3)4)19-13-8-6-5-7-12(13)18-15/h5-8,10-11H,9H2,1-4H3 |
| InChIKey | NJNZSCGBNYPZRU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline?
The IUPAC name of 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline (CID 71133448) is 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline.
What is the SMILES notation for 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline?
The canonical SMILES for 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline is CC1CC=C(c2nc3ccccc3nc2OC(C)(C)C)S1.
What is the InChIKey of 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline?
The InChIKey is NJNZSCGBNYPZRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20N2OS/c1-11-9-10-14(21-11)15-16(20-17(2,3)4)19-13-8-6-5-7-12(13)18-15/h5-8,10-11H,9H2,1-4H3.
What are the key properties of 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline?
2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline has a molecular weight of 300.43 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methyl-2,3-dihydrothiophen-5-yl)-3-[(2-methylpropan-2-yl)oxy]quinoxaline is sourced from PubChem (CID 71133448), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).