C10H7Cl2F3O — CID 71133679
3-(3,5-dichlorophenyl)-4,4,4-trifluorobutan-2-one (PubChem CID 71133679) has the molecular formula C10H7Cl2F3O and a molecular weight of 271.07 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4,4,4-trifluorobutan-2-one.
| Compound Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluorobutan-2-one |
|---|---|
| PubChem CID | 71133679 |
| Molecular Formula | C10H7Cl2F3O |
| Molecular Weight | 271.07 g/mol |
| Exact Mass | 269.98 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluorobutan-2-one |
| SMILES | CC(=O)C(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H7Cl2F3O/c1-5(16)9(10(13,14)15)6-2-7(11)4-8(12)3-6/h2-4,9H,1H3 |
| InChIKey | JNJZMHDMGPMGMJ-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.07 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |