About 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine
1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine (PubChem CID 71133721) has the molecular formula C16H27NO
and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine.
Molecular Properties
| Compound Name | 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine |
| PubChem CID | 71133721 |
| Molecular Formula | C16H27NO |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.21 |
| IUPAC Name | 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine |
| SMILES | CC1=C(C2CCN(C)CC2)C=C(OC(C)C)CC1 |
| InChI | InChI=1S/C16H27NO/c1-12(2)18-15-6-5-13(3)16(11-15)14-7-9-17(4)10-8-14/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | FXHQHUCXNCKEAU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine?
The IUPAC name of 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine (CID 71133721) is 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine.
What is the SMILES notation for 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine?
The canonical SMILES for 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine is CC1=C(C2CCN(C)CC2)C=C(OC(C)C)CC1.
What is the InChIKey of 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine?
The InChIKey is FXHQHUCXNCKEAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H27NO/c1-12(2)18-15-6-5-13(3)16(11-15)14-7-9-17(4)10-8-14/h11-12,14H,5-10H2,1-4H3.
What are the key properties of 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine?
1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine has a molecular weight of 249.40 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4-(2-methyl-5-propan-2-yloxycyclohexa-1,5-dien-1-yl)piperidine is sourced from PubChem (CID 71133721), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).