C27H38FN7O2 — CID 71133740
N-[(1S)-2-[2-[2-amino-6-(N-amino-4-fluoroanilino)-4-pyridinyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide (PubChem CID 71133740) has the molecular formula C27H38FN7O2 and a molecular weight of 511.65 g/mol. Its IUPAC name is N-[(1S)-2-[2-[2-amino-6-(N-amino-4-fluoroanilino)-4-pyridinyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide.
| Compound Name | N-[(1S)-2-[2-[2-amino-6-(N-amino-4-fluoroanilino)-4-pyridinyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
|---|---|
| PubChem CID | 71133740 |
| Molecular Formula | C27H38FN7O2 |
| Molecular Weight | 511.65 g/mol |
| Exact Mass | 511.31 |
| IUPAC Name | N-[(1S)-2-[2-[2-amino-6-(N-amino-4-fluoroanilino)-4-pyridinyl]pyrrolidin-1-yl]-1-cyclohexyl-2-oxoethyl]-2-(methylamino)propanamide |
| SMILES | CNC(C)C(=O)N[C@H](C(=O)N1CCCC1c1cc(N)nc(N(N)c2ccc(F)cc2)c1)C1CCCCC1 |
| InChI | InChI=1S/C27H38FN7O2/c1-17(31-2)26(36)33-25(18-7-4-3-5-8-18)27(37)34-14-6-9-22(34)19-15-23(29)32-24(16-19)35(30)21-12-10-20(28)11-13-21/h10-13,15-18,22,25,31H,3-9,14,30H2,1-2H3,(H2,29,32)(H,33,36)/t17?,22?,25-/m0/s1 |
| InChIKey | NOMHWZSBPZAKRF-AXCVFNIJSA-N |
| XLogP | 3.15 |
| TPSA | 129.61 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.65 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|