About [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate
[4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate (PubChem CID 71134023) has the molecular formula C28H28F2N2O4
and a molecular weight of 494.54 g/mol. Its IUPAC name is [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate.
Molecular Properties
| Compound Name | [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate |
| PubChem CID | 71134023 |
| Molecular Formula | C28H28F2N2O4 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate |
| SMILES | O=C(NCc1ccc(F)c(F)c1)OC1(c2ccccc2)CCN(C(=O)COCc2ccccc2)CC1 |
| InChI | InChI=1S/C28H28F2N2O4/c29-24-12-11-22(17-25(24)30)18-31-27(34)36-28(23-9-5-2-6-10-23)13-15-32(16-14-28)26(33)20-35-19-21-7-3-1-4-8-21/h1-12,17H,13-16,18-20H2,(H,31,34) |
| InChIKey | FKCVSCQBBHTKFH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate?
The IUPAC name of [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate (CID 71134023) is [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate.
What is the SMILES notation for [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate?
The canonical SMILES for [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate is O=C(NCc1ccc(F)c(F)c1)OC1(c2ccccc2)CCN(C(=O)COCc2ccccc2)CC1.
What is the InChIKey of [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate?
The InChIKey is FKCVSCQBBHTKFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H28F2N2O4/c29-24-12-11-22(17-25(24)30)18-31-27(34)36-28(23-9-5-2-6-10-23)13-15-32(16-14-28)26(33)20-35-19-21-7-3-1-4-8-21/h1-12,17H,13-16,18-20H2,(H,31,34).
What are the key properties of [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate?
[4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate has a molecular weight of 494.54 g/mol, XLogP of 4.93, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-phenyl-1-(2-phenylmethoxyacetyl)piperidin-4-yl] N-[(3,4-difluorophenyl)methyl]carbamate is sourced from PubChem (CID 71134023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).