C19H14FN5O2 — CID 71134297
(2-pyridin-2-ylpyrimidin-5-yl) N-(5-fluoro-2-methylindol-1-yl)carbamate (PubChem CID 71134297) has the molecular formula C19H14FN5O2 and a molecular weight of 363.35 g/mol. Its IUPAC name is (2-pyridin-2-ylpyrimidin-5-yl) N-(5-fluoro-2-methylindol-1-yl)carbamate.
| Compound Name | (2-pyridin-2-ylpyrimidin-5-yl) N-(5-fluoro-2-methylindol-1-yl)carbamate |
|---|---|
| PubChem CID | 71134297 |
| Molecular Formula | C19H14FN5O2 |
| Molecular Weight | 363.35 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (2-pyridin-2-ylpyrimidin-5-yl) N-(5-fluoro-2-methylindol-1-yl)carbamate |
| SMILES | Cc1cc2cc(F)ccc2n1NC(=O)Oc1cnc(-c2ccccn2)nc1 |
| InChI | InChI=1S/C19H14FN5O2/c1-12-8-13-9-14(20)5-6-17(13)25(12)24-19(26)27-15-10-22-18(23-11-15)16-4-2-3-7-21-16/h2-11H,1H3,(H,24,26) |
| InChIKey | VSCKVNKDVHPLMQ-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |