About (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate
(2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate (PubChem CID 71134367) has the molecular formula C19H15FN4O3
and a molecular weight of 366.35 g/mol. Its IUPAC name is (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate.
Molecular Properties
| Compound Name | (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate |
| PubChem CID | 71134367 |
| Molecular Formula | C19H15FN4O3 |
| Molecular Weight | 366.35 g/mol |
| Exact Mass | 366.11 |
| IUPAC Name | (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate |
| SMILES | O=C(NN1CCOc2ccc(F)cc21)Oc1cnc(-c2ccccc2)nc1 |
| InChI | InChI=1S/C19H15FN4O3/c20-14-6-7-17-16(10-14)24(8-9-26-17)23-19(25)27-15-11-21-18(22-12-15)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2,(H,23,25) |
| InChIKey | NOLUZUFQUAHPQV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 366.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate?
The IUPAC name of (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate (CID 71134367) is (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate.
What is the SMILES notation for (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate?
The canonical SMILES for (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate is O=C(NN1CCOc2ccc(F)cc21)Oc1cnc(-c2ccccc2)nc1.
What is the InChIKey of (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate?
The InChIKey is NOLUZUFQUAHPQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15FN4O3/c20-14-6-7-17-16(10-14)24(8-9-26-17)23-19(25)27-15-11-21-18(22-12-15)13-4-2-1-3-5-13/h1-7,10-12H,8-9H2,(H,23,25).
What are the key properties of (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate?
(2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate has a molecular weight of 366.35 g/mol, XLogP of 3.19, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenylpyrimidin-5-yl) N-(6-fluoro-2,3-dihydro-1,4-benzoxazin-4-yl)carbamate is sourced from PubChem (CID 71134367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).