About (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one
(11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one (PubChem CID 71134582) has the molecular formula C18H18N2O
and a molecular weight of 278.35 g/mol. Its IUPAC name is (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one.
Molecular Properties
| Compound Name | (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one |
| PubChem CID | 71134582 |
| Molecular Formula | C18H18N2O |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one |
| SMILES | CCC/C(C)=C1\c2ccccc2C(=O)Nc2cccnc21 |
| InChI | InChI=1S/C18H18N2O/c1-3-7-12(2)16-13-8-4-5-9-14(13)18(21)20-15-10-6-11-19-17(15)16/h4-6,8-11H,3,7H2,1-2H3,(H,20,21)/b16-12+ |
| InChIKey | OCURSTGRPUYHOQ-FOWTUZBSSA-N |
| XLogP | 4.27 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one?
The IUPAC name of (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one (CID 71134582) is (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one.
What is the SMILES notation for (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one?
The canonical SMILES for (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one is CCC/C(C)=C1\c2ccccc2C(=O)Nc2cccnc21.
What is the InChIKey of (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one?
The InChIKey is OCURSTGRPUYHOQ-FOWTUZBSSA-N. The full InChI is InChI=1S/C18H18N2O/c1-3-7-12(2)16-13-8-4-5-9-14(13)18(21)20-15-10-6-11-19-17(15)16/h4-6,8-11H,3,7H2,1-2H3,(H,20,21)/b16-12+.
What are the key properties of (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one?
(11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one has a molecular weight of 278.35 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (11E)-11-pentan-2-ylidene-5H-pyrido[3,2-c][2]benzazepin-6-one is sourced from PubChem (CID 71134582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).