About 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid
4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid (PubChem CID 71134739) has the molecular formula C26H27FO4
and a molecular weight of 422.50 g/mol. Its IUPAC name is 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid.
Molecular Properties
| Compound Name | 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid |
| PubChem CID | 71134739 |
| Molecular Formula | C26H27FO4 |
| Molecular Weight | 422.50 g/mol |
| Exact Mass | 422.19 |
| IUPAC Name | 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid |
| SMILES | CC(CCc1ccccc1)Oc1c(C(=O)CC(C)(C)C(=O)O)cc(F)c2ccccc12 |
| InChI | InChI=1S/C26H27FO4/c1-17(13-14-18-9-5-4-6-10-18)31-24-20-12-8-7-11-19(20)22(27)15-21(24)23(28)16-26(2,3)25(29)30/h4-12,15,17H,13-14,16H2,1-3H3,(H,29,30) |
| InChIKey | ZUUCSOLCPHRXBA-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.50 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid?
The IUPAC name of 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid (CID 71134739) is 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid.
What is the SMILES notation for 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid?
The canonical SMILES for 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid is CC(CCc1ccccc1)Oc1c(C(=O)CC(C)(C)C(=O)O)cc(F)c2ccccc12.
What is the InChIKey of 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid?
The InChIKey is ZUUCSOLCPHRXBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H27FO4/c1-17(13-14-18-9-5-4-6-10-18)31-24-20-12-8-7-11-19(20)22(27)15-21(24)23(28)16-26(2,3)25(29)30/h4-12,15,17H,13-14,16H2,1-3H3,(H,29,30).
What are the key properties of 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid?
4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid has a molecular weight of 422.50 g/mol, XLogP of 6.06, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-fluoro-1-(4-phenylbutan-2-yloxy)naphthalen-2-yl]-2,2-dimethyl-4-oxobutanoic acid is sourced from PubChem (CID 71134739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).