C11H14F3N3 — CID 71134819
2-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidine (PubChem CID 71134819) has the molecular formula C11H14F3N3 and a molecular weight of 245.25 g/mol. Its IUPAC name is 2-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidine.
| Compound Name | 2-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 71134819 |
| Molecular Formula | C11H14F3N3 |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 2-(3-methylpiperidin-1-yl)-5-(trifluoromethyl)pyrimidine |
| SMILES | CC1CCCN(c2ncc(C(F)(F)F)cn2)C1 |
| InChI | InChI=1S/C11H14F3N3/c1-8-3-2-4-17(7-8)10-15-5-9(6-16-10)11(12,13)14/h5-6,8H,2-4,7H2,1H3 |
| InChIKey | HDNSGQUWGXWAAA-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |