C26H28FN3O4 — CID 71135095
methyl 4-[cyclopropyl-[6-fluoro-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate (PubChem CID 71135095) has the molecular formula C26H28FN3O4 and a molecular weight of 465.53 g/mol. Its IUPAC name is methyl 4-[cyclopropyl-[6-fluoro-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate.
| Compound Name | methyl 4-[cyclopropyl-[6-fluoro-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 71135095 |
| Molecular Formula | C26H28FN3O4 |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.21 |
| IUPAC Name | methyl 4-[cyclopropyl-[6-fluoro-4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoate |
| SMILES | COC(=O)CCC(=O)N(C1CC1)C1c2ccc(F)cc2N(C(=O)c2cccnc2)C2CCCC21 |
| InChI | InChI=1S/C26H28FN3O4/c1-34-24(32)12-11-23(31)29(18-8-9-18)25-19-5-2-6-21(19)30(22-14-17(27)7-10-20(22)25)26(33)16-4-3-13-28-15-16/h3-4,7,10,13-15,18-19,21,25H,2,5-6,8-9,11-12H2,1H3 |
| InChIKey | UUWHQABEUKFDEI-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |