C15H25N — CID 71135169
1,4-dimethyl-4a,5,6,7,8,9,10,11,12,12a-decahydrocyclodeca[c]pyridine (PubChem CID 71135169) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 1,4-dimethyl-4a,5,6,7,8,9,10,11,12,12a-decahydrocyclodeca[c]pyridine.
| Compound Name | 1,4-dimethyl-4a,5,6,7,8,9,10,11,12,12a-decahydrocyclodeca[c]pyridine |
|---|---|
| PubChem CID | 71135169 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 1,4-dimethyl-4a,5,6,7,8,9,10,11,12,12a-decahydrocyclodeca[c]pyridine |
| SMILES | CC1=CN=C(C)C2CCCCCCCCC12 |
| InChI | InChI=1S/C15H25N/c1-12-11-16-13(2)15-10-8-6-4-3-5-7-9-14(12)15/h11,14-15H,3-10H2,1-2H3 |
| InChIKey | DQTRVMXAPJMBMW-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |