C14H20O5 — CID 71135324
4-(7-ethyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)butanoic acid (PubChem CID 71135324) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-(7-ethyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)butanoic acid.
| Compound Name | 4-(7-ethyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)butanoic acid |
|---|---|
| PubChem CID | 71135324 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(7-ethyl-1-hydroxy-3-oxo-3a,4,7,7a-tetrahydro-1H-2-benzofuran-4-yl)butanoic acid |
| SMILES | CCC1C=CC(CCCC(=O)O)C2C(=O)OC(O)C12 |
| InChI | InChI=1S/C14H20O5/c1-2-8-6-7-9(4-3-5-10(15)16)12-11(8)13(17)19-14(12)18/h6-9,11-13,17H,2-5H2,1H3,(H,15,16) |
| InChIKey | YZKNRVVLSNRREZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|