C24H27N3O4 — CID 71136570
4-[ethyl-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid (PubChem CID 71136570) has the molecular formula C24H27N3O4 and a molecular weight of 421.50 g/mol. Its IUPAC name is 4-[ethyl-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[ethyl-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71136570 |
| Molecular Formula | C24H27N3O4 |
| Molecular Weight | 421.50 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 4-[ethyl-[4-(pyridine-3-carbonyl)-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]amino]-4-oxobutanoic acid |
| SMILES | CCN(C(=O)CCC(=O)O)C1c2ccccc2N(C(=O)c2cccnc2)C2CCCC12 |
| InChI | InChI=1S/C24H27N3O4/c1-2-26(21(28)12-13-22(29)30)23-17-8-3-4-10-19(17)27(20-11-5-9-18(20)23)24(31)16-7-6-14-25-15-16/h3-4,6-8,10,14-15,18,20,23H,2,5,9,11-13H2,1H3,(H,29,30) |
| InChIKey | BLIJPEFRLLSXBN-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 90.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.50 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |