About (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one
(5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one (PubChem CID 71136608) has the molecular formula C15H27NO3
and a molecular weight of 269.38 g/mol. Its IUPAC name is (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one.
Molecular Properties
| Compound Name | (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one |
| PubChem CID | 71136608 |
| Molecular Formula | C15H27NO3 |
| Molecular Weight | 269.38 g/mol |
| Exact Mass | 269.20 |
| IUPAC Name | (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one |
| SMILES | CC(C)(C)CN1C[C@@]2(CCC[C@](C)(CO)C2)OC1=O |
| InChI | InChI=1S/C15H27NO3/c1-13(2,3)9-16-10-15(19-12(16)18)7-5-6-14(4,8-15)11-17/h17H,5-11H2,1-4H3/t14-,15-/m0/s1 |
| InChIKey | CTFKAWSIVBLMMT-GJZGRUSLSA-N |
| XLogP | 2.80 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one?
The IUPAC name of (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one (CID 71136608) is (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one.
What is the SMILES notation for (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one?
The canonical SMILES for (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one is CC(C)(C)CN1C[C@@]2(CCC[C@](C)(CO)C2)OC1=O.
What is the InChIKey of (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one?
The InChIKey is CTFKAWSIVBLMMT-GJZGRUSLSA-N. The full InChI is InChI=1S/C15H27NO3/c1-13(2,3)9-16-10-15(19-12(16)18)7-5-6-14(4,8-15)11-17/h17H,5-11H2,1-4H3/t14-,15-/m0/s1.
What are the key properties of (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one?
(5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one has a molecular weight of 269.38 g/mol, XLogP of 2.80, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S,7S)-3-(2,2-dimethylpropyl)-7-(hydroxymethyl)-7-methyl-1-oxa-3-azaspiro[4.5]decan-2-one is sourced from PubChem (CID 71136608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).