About (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate
(2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate (PubChem CID 7113663) has the molecular formula C19H14NO5-
and a molecular weight of 336.32 g/mol. Its IUPAC name is (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate.
Molecular Properties
| Compound Name | (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate |
| PubChem CID | 7113663 |
| Molecular Formula | C19H14NO5- |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate |
| SMILES | O=C1Oc2ccccc2C(=O)C1/C=N/[C@H](Cc1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C19H15NO5/c21-17-13-8-4-5-9-16(13)25-19(24)14(17)11-20-15(18(22)23)10-12-6-2-1-3-7-12/h1-9,11,14-15H,10H2,(H,22,23)/p-1/b20-11+/t14?,15-/m1/s1 |
| InChIKey | CQYICAUODBNFDB-WHJZEWBLSA-M |
| XLogP | 0.84 |
| TPSA | 95.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate?
The IUPAC name of (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate (CID 7113663) is (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate.
What is the SMILES notation for (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate?
The canonical SMILES for (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate is O=C1Oc2ccccc2C(=O)C1/C=N/[C@H](Cc1ccccc1)C(=O)[O-].
What is the InChIKey of (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate?
The InChIKey is CQYICAUODBNFDB-WHJZEWBLSA-M. The full InChI is InChI=1S/C19H15NO5/c21-17-13-8-4-5-9-16(13)25-19(24)14(17)11-20-15(18(22)23)10-12-6-2-1-3-7-12/h1-9,11,14-15H,10H2,(H,22,23)/p-1/b20-11+/t14?,15-/m1/s1.
What are the key properties of (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate?
(2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate has a molecular weight of 336.32 g/mol, XLogP of 0.84, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(2,4-dioxochromen-3-yl)methylideneamino]-3-phenylpropanoate is sourced from PubChem (CID 7113663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).