About 5-hexyl-3-pentyl-1,2-dihydrotriazole
5-hexyl-3-pentyl-1,2-dihydrotriazole (PubChem CID 71136783) has the molecular formula C13H27N3
and a molecular weight of 225.38 g/mol. Its IUPAC name is 5-hexyl-3-pentyl-1,2-dihydrotriazole.
Molecular Properties
| Compound Name | 5-hexyl-3-pentyl-1,2-dihydrotriazole |
| PubChem CID | 71136783 |
| Molecular Formula | C13H27N3 |
| Molecular Weight | 225.38 g/mol |
| Exact Mass | 225.22 |
| IUPAC Name | 5-hexyl-3-pentyl-1,2-dihydrotriazole |
| SMILES | CCCCCCC1=CN(CCCCC)NN1 |
| InChI | InChI=1S/C13H27N3/c1-3-5-7-8-10-13-12-16(15-14-13)11-9-6-4-2/h12,14-15H,3-11H2,1-2H3 |
| InChIKey | BMRLNEAZGZNLJQ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.38 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-hexyl-3-pentyl-1,2-dihydrotriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hexyl-3-pentyl-1,2-dihydrotriazole?
The IUPAC name of 5-hexyl-3-pentyl-1,2-dihydrotriazole (CID 71136783) is 5-hexyl-3-pentyl-1,2-dihydrotriazole.
What is the SMILES notation for 5-hexyl-3-pentyl-1,2-dihydrotriazole?
The canonical SMILES for 5-hexyl-3-pentyl-1,2-dihydrotriazole is CCCCCCC1=CN(CCCCC)NN1.
What is the InChIKey of 5-hexyl-3-pentyl-1,2-dihydrotriazole?
The InChIKey is BMRLNEAZGZNLJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27N3/c1-3-5-7-8-10-13-12-16(15-14-13)11-9-6-4-2/h12,14-15H,3-11H2,1-2H3.
What are the key properties of 5-hexyl-3-pentyl-1,2-dihydrotriazole?
5-hexyl-3-pentyl-1,2-dihydrotriazole has a molecular weight of 225.38 g/mol, XLogP of 3.31, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hexyl-3-pentyl-1,2-dihydrotriazole is sourced from PubChem (CID 71136783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).