About 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide
3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide (PubChem CID 71137000) has the molecular formula C23H19ClN2OS
and a molecular weight of 406.94 g/mol. Its IUPAC name is 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide.
Molecular Properties
| Compound Name | 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide |
| PubChem CID | 71137000 |
| Molecular Formula | C23H19ClN2OS |
| Molecular Weight | 406.94 g/mol |
| Exact Mass | 406.09 |
| IUPAC Name | 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide |
| SMILES | Cc1ccc(N(Cc2ccncc2)C(=O)c2sc3ccccc3c2Cl)c(C)c1 |
| InChI | InChI=1S/C23H19ClN2OS/c1-15-7-8-19(16(2)13-15)26(14-17-9-11-25-12-10-17)23(27)22-21(24)18-5-3-4-6-20(18)28-22/h3-13H,14H2,1-2H3 |
| InChIKey | UNGVVQUYUDKUQV-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 406.94 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide?
The IUPAC name of 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide (CID 71137000) is 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide.
What is the SMILES notation for 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide?
The canonical SMILES for 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide is Cc1ccc(N(Cc2ccncc2)C(=O)c2sc3ccccc3c2Cl)c(C)c1.
What is the InChIKey of 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide?
The InChIKey is UNGVVQUYUDKUQV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H19ClN2OS/c1-15-7-8-19(16(2)13-15)26(14-17-9-11-25-12-10-17)23(27)22-21(24)18-5-3-4-6-20(18)28-22/h3-13H,14H2,1-2H3.
What are the key properties of 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide?
3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide has a molecular weight of 406.94 g/mol, XLogP of 6.41, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-N-(2,4-dimethylphenyl)-N-(pyridin-4-ylmethyl)-1-benzothiophene-2-carboxamide is sourced from PubChem (CID 71137000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).