C17H10ClF3N2O2S — CID 71137020
2-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]-3-(4-fluorophenyl)imidazole-4-carboxylic acid (PubChem CID 71137020) has the molecular formula C17H10ClF3N2O2S and a molecular weight of 398.79 g/mol. Its IUPAC name is 2-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]-3-(4-fluorophenyl)imidazole-4-carboxylic acid.
| Compound Name | 2-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]-3-(4-fluorophenyl)imidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 71137020 |
| Molecular Formula | C17H10ClF3N2O2S |
| Molecular Weight | 398.79 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | 2-[(2-chloro-4,5-difluorophenyl)methylsulfanyl]-3-(4-fluorophenyl)imidazole-4-carboxylic acid |
| SMILES | O=C(O)c1cnc(SCc2cc(F)c(F)cc2Cl)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C17H10ClF3N2O2S/c18-12-6-14(21)13(20)5-9(12)8-26-17-22-7-15(16(24)25)23(17)11-3-1-10(19)2-4-11/h1-7H,8H2,(H,24,25) |
| InChIKey | GQKBAFNEIATRSJ-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.79 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|