About 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene
3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene (PubChem CID 71137591) has the molecular formula C16H28S
and a molecular weight of 252.47 g/mol. Its IUPAC name is 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene |
| PubChem CID | 71137591 |
| Molecular Formula | C16H28S |
| Molecular Weight | 252.47 g/mol |
| Exact Mass | 252.19 |
| IUPAC Name | 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene |
| SMILES | CC1=CC(C(C)(C)C)=CC(C)C1SC(C)(C)C |
| InChI | InChI=1S/C16H28S/c1-11-9-13(15(3,4)5)10-12(2)14(11)17-16(6,7)8/h9-11,14H,1-8H3 |
| InChIKey | TXNKURUAFAWIMH-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.47 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene?
The IUPAC name of 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene (CID 71137591) is 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene.
What is the SMILES notation for 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene?
The canonical SMILES for 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene is CC1=CC(C(C)(C)C)=CC(C)C1SC(C)(C)C.
What is the InChIKey of 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene?
The InChIKey is TXNKURUAFAWIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28S/c1-11-9-13(15(3,4)5)10-12(2)14(11)17-16(6,7)8/h9-11,14H,1-8H3.
What are the key properties of 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene?
3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene has a molecular weight of 252.47 g/mol, XLogP of 5.46, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-6-tert-butylsulfanyl-1,5-dimethylcyclohexa-1,3-diene is sourced from PubChem (CID 71137591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).