C20H28N4O — CID 71137776
4-[1-[(2-methyl-1H-indol-4-yl)methyl]piperidin-4-yl]-1,4-diazepan-2-one (PubChem CID 71137776) has the molecular formula C20H28N4O and a molecular weight of 340.47 g/mol. Its IUPAC name is 4-[1-[(2-methyl-1H-indol-4-yl)methyl]piperidin-4-yl]-1,4-diazepan-2-one.
| Compound Name | 4-[1-[(2-methyl-1H-indol-4-yl)methyl]piperidin-4-yl]-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 71137776 |
| Molecular Formula | C20H28N4O |
| Molecular Weight | 340.47 g/mol |
| Exact Mass | 340.23 |
| IUPAC Name | 4-[1-[(2-methyl-1H-indol-4-yl)methyl]piperidin-4-yl]-1,4-diazepan-2-one |
| SMILES | Cc1cc2c(CN3CCC(N4CCCNC(=O)C4)CC3)cccc2[nH]1 |
| InChI | InChI=1S/C20H28N4O/c1-15-12-18-16(4-2-5-19(18)22-15)13-23-10-6-17(7-11-23)24-9-3-8-21-20(25)14-24/h2,4-5,12,17,22H,3,6-11,13-14H2,1H3,(H,21,25) |
| InChIKey | WALDUHMMUDTWSW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 51.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.47 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |