C21H40O5Si2 — CID 71137965
(3aS,6S,7S,7aS)-6-hydroxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-3,3a,7,7a-tetrahydro-1-benzofuran-2-one (PubChem CID 71137965) has the molecular formula C21H40O5Si2 and a molecular weight of 428.72 g/mol. Its IUPAC name is (3aS,6S,7S,7aS)-6-hydroxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-3,3a,7,7a-tetrahydro-1-benzofuran-2-one.
| Compound Name | (3aS,6S,7S,7aS)-6-hydroxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-3,3a,7,7a-tetrahydro-1-benzofuran-2-one |
|---|---|
| PubChem CID | 71137965 |
| Molecular Formula | C21H40O5Si2 |
| Molecular Weight | 428.72 g/mol |
| Exact Mass | 428.24 |
| IUPAC Name | (3aS,6S,7S,7aS)-6-hydroxy-6-[3-[hydroxy(dimethyl)silyl]-3-methylbutyl]-7-[2-[hydroxy(dimethyl)silyl]-2-methylpropyl]-3,3a,7,7a-tetrahydro-1-benzofuran-2-one |
| SMILES | CC(C)(CC[C@]1(O)C=C[C@@H]2CC(=O)O[C@@H]2[C@@H]1CC(C)(C)[Si](C)(C)O)[Si](C)(C)O |
| InChI | InChI=1S/C21H40O5Si2/c1-19(2,27(5,6)24)11-12-21(23)10-9-15-13-17(22)26-18(15)16(21)14-20(3,4)28(7,8)25/h9-10,15-16,18,23-25H,11-14H2,1-8H3/t15-,16+,18+,21-/m1/s1 |
| InChIKey | OIPSAECSXCQPCA-JIYIMXKPSA-N |
| XLogP | 3.96 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.72 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|