About 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol
4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol (PubChem CID 71138842) has the molecular formula C15H22O4
and a molecular weight of 266.34 g/mol. Its IUPAC name is 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol.
Molecular Properties
| Compound Name | 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol |
| PubChem CID | 71138842 |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol |
| SMILES | CCCC[C@H]1CO[C@H](c2ccc(O)c(OCC)c2)O1 |
| InChI | InChI=1S/C15H22O4/c1-3-5-6-12-10-18-15(19-12)11-7-8-13(16)14(9-11)17-4-2/h7-9,12,15-16H,3-6,10H2,1-2H3/t12-,15-/m0/s1 |
| InChIKey | KFNNWMFPDLPWHQ-WFASDCNBSA-N |
| XLogP | 3.40 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol?
The IUPAC name of 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol (CID 71138842) is 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol.
What is the SMILES notation for 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol?
The canonical SMILES for 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol is CCCC[C@H]1CO[C@H](c2ccc(O)c(OCC)c2)O1.
What is the InChIKey of 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol?
The InChIKey is KFNNWMFPDLPWHQ-WFASDCNBSA-N. The full InChI is InChI=1S/C15H22O4/c1-3-5-6-12-10-18-15(19-12)11-7-8-13(16)14(9-11)17-4-2/h7-9,12,15-16H,3-6,10H2,1-2H3/t12-,15-/m0/s1.
What are the key properties of 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol?
4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol has a molecular weight of 266.34 g/mol, XLogP of 3.40, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2S,4S)-4-butyl-1,3-dioxolan-2-yl]-2-ethoxyphenol is sourced from PubChem (CID 71138842), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).