C29H31ClN2O4 — CID 71139283
4-[[(3aR,9R,9aS)-6-chloro-4-[(1R,2R)-2-phenylcyclopropanecarbonyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid (PubChem CID 71139283) has the molecular formula C29H31ClN2O4 and a molecular weight of 507.03 g/mol. Its IUPAC name is 4-[[(3aR,9R,9aS)-6-chloro-4-[(1R,2R)-2-phenylcyclopropanecarbonyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid.
| Compound Name | 4-[[(3aR,9R,9aS)-6-chloro-4-[(1R,2R)-2-phenylcyclopropanecarbonyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 71139283 |
| Molecular Formula | C29H31ClN2O4 |
| Molecular Weight | 507.03 g/mol |
| Exact Mass | 506.20 |
| IUPAC Name | 4-[[(3aR,9R,9aS)-6-chloro-4-[(1R,2R)-2-phenylcyclopropanecarbonyl]-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl]-cyclopropylamino]-4-oxobutanoic acid |
| SMILES | O=C(O)CCC(=O)N(C1CC1)[C@H]1c2ccc(Cl)cc2N(C(=O)[C@@H]2C[C@H]2c2ccccc2)[C@@H]2CCC[C@@H]21 |
| InChI | InChI=1S/C29H31ClN2O4/c30-18-9-12-21-25(15-18)32(29(36)23-16-22(23)17-5-2-1-3-6-17)24-8-4-7-20(24)28(21)31(19-10-11-19)26(33)13-14-27(34)35/h1-3,5-6,9,12,15,19-20,22-24,28H,4,7-8,10-11,13-14,16H2,(H,34,35)/t20-,22-,23+,24+,28+/m0/s1 |
| InChIKey | AQXKWRUYGVFHLP-FRIRSKFKSA-N |
| XLogP | 5.56 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.03 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |