C27H27F3N4O6S — CID 7113931
(1R,9R)-N-(3,5-dimethoxyphenyl)-6-oxo-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide (PubChem CID 7113931) has the molecular formula C27H27F3N4O6S and a molecular weight of 592.60 g/mol. Its IUPAC name is (1R,9R)-N-(3,5-dimethoxyphenyl)-6-oxo-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide.
| Compound Name | (1R,9R)-N-(3,5-dimethoxyphenyl)-6-oxo-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
|---|---|
| PubChem CID | 7113931 |
| Molecular Formula | C27H27F3N4O6S |
| Molecular Weight | 592.60 g/mol |
| Exact Mass | 592.16 |
| IUPAC Name | (1R,9R)-N-(3,5-dimethoxyphenyl)-6-oxo-5-[[3-(trifluoromethyl)phenyl]sulfonylamino]-7,11-diazatricyclo[7.3.1.02,7]trideca-2,4-diene-11-carboxamide |
| SMILES | COc1cc(NC(=O)N2C[C@@H]3C[C@H](C2)c2ccc(NS(=O)(=O)c4cccc(C(F)(F)F)c4)c(=O)n2C3)cc(OC)c1 |
| InChI | InChI=1S/C27H27F3N4O6S/c1-39-20-10-19(11-21(12-20)40-2)31-26(36)33-13-16-8-17(15-33)24-7-6-23(25(35)34(24)14-16)32-41(37,38)22-5-3-4-18(9-22)27(28,29)30/h3-7,9-12,16-17,32H,8,13-15H2,1-2H3,(H,31,36)/t16-,17+/m0/s1 |
| InChIKey | JERCGROYDIGNDT-DLBZAZTESA-N |
| XLogP | 4.34 |
| TPSA | 118.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.60 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |