C25H28N2O4 — CID 71139376
5-[(4-benzoyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)methylamino]-5-oxopentanoic acid (PubChem CID 71139376) has the molecular formula C25H28N2O4 and a molecular weight of 420.51 g/mol. Its IUPAC name is 5-[(4-benzoyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)methylamino]-5-oxopentanoic acid.
| Compound Name | 5-[(4-benzoyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)methylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 71139376 |
| Molecular Formula | C25H28N2O4 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | 5-[(4-benzoyl-1,2,3,3a,9,9a-hexahydrocyclopenta[b]quinolin-9-yl)methylamino]-5-oxopentanoic acid |
| SMILES | O=C(O)CCCC(=O)NCC1c2ccccc2N(C(=O)c2ccccc2)C2CCCC12 |
| InChI | InChI=1S/C25H28N2O4/c28-23(14-7-15-24(29)30)26-16-20-18-10-4-5-12-21(18)27(22-13-6-11-19(20)22)25(31)17-8-2-1-3-9-17/h1-5,8-10,12,19-20,22H,6-7,11,13-16H2,(H,26,28)(H,29,30) |
| InChIKey | SMWSXXWFZNRICM-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |