C17H21N5O — CID 71140029
1-(8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-yl)cyclohexane-1,2-diamine (PubChem CID 71140029) has the molecular formula C17H21N5O and a molecular weight of 311.39 g/mol. Its IUPAC name is 1-(8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-yl)cyclohexane-1,2-diamine.
| Compound Name | 1-(8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-yl)cyclohexane-1,2-diamine |
|---|---|
| PubChem CID | 71140029 |
| Molecular Formula | C17H21N5O |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.17 |
| IUPAC Name | 1-(8-methoxy-3H-pyrazolo[5,4-c]quinolin-4-yl)cyclohexane-1,2-diamine |
| SMILES | COc1ccc2nc(C3(N)CCCCC3N)c3[nH]ncc3c2c1 |
| InChI | InChI=1S/C17H21N5O/c1-23-10-5-6-13-11(8-10)12-9-20-22-15(12)16(21-13)17(19)7-3-2-4-14(17)18/h5-6,8-9,14H,2-4,7,18-19H2,1H3,(H,20,22) |
| InChIKey | HHWPELNPKHFJAT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 102.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |