C25H26F2N2O4 — CID 71140399
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-5-(3,5-difluorophenyl)-2-(ethylamino)-4,5-dioxopentanoic acid (PubChem CID 71140399) has the molecular formula C25H26F2N2O4 and a molecular weight of 456.49 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-5-(3,5-difluorophenyl)-2-(ethylamino)-4,5-dioxopentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-5-(3,5-difluorophenyl)-2-(ethylamino)-4,5-dioxopentanoic acid |
|---|---|
| PubChem CID | 71140399 |
| Molecular Formula | C25H26F2N2O4 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-5-(3,5-difluorophenyl)-2-(ethylamino)-4,5-dioxopentanoic acid |
| SMILES | CCNC(CC(=O)C(=O)c1cc(F)cc(F)c1)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C25H26F2N2O4/c1-2-28-25(24(32)33,13-21(30)23(31)14-10-15(26)12-16(27)11-14)22-17-6-3-4-8-19(17)29-20-9-5-7-18(20)22/h3-4,6,8,10-12,18,20,22,28-29H,2,5,7,9,13H2,1H3,(H,32,33)/t18-,20+,22?,25?/m0/s1 |
| InChIKey | WGIMANXSAUIRMX-YXXFSUHQSA-N |
| XLogP | 3.92 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|