C27H26N4O4 — CID 71140407
2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-(3-pyridazin-4-ylphenyl)pentanoic acid (PubChem CID 71140407) has the molecular formula C27H26N4O4 and a molecular weight of 470.53 g/mol. Its IUPAC name is 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-(3-pyridazin-4-ylphenyl)pentanoic acid.
| Compound Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-(3-pyridazin-4-ylphenyl)pentanoic acid |
|---|---|
| PubChem CID | 71140407 |
| Molecular Formula | C27H26N4O4 |
| Molecular Weight | 470.53 g/mol |
| Exact Mass | 470.20 |
| IUPAC Name | 2-[(3aR,9aR)-2,3,3a,4,9,9a-hexahydro-1H-cyclopenta[b]quinolin-9-yl]-2-amino-4,5-dioxo-5-(3-pyridazin-4-ylphenyl)pentanoic acid |
| SMILES | NC(CC(=O)C(=O)c1cccc(-c2ccnnc2)c1)(C(=O)O)C1c2ccccc2N[C@@H]2CCC[C@H]12 |
| InChI | InChI=1S/C27H26N4O4/c28-27(26(34)35,24-19-7-1-2-9-21(19)31-22-10-4-8-20(22)24)14-23(32)25(33)17-6-3-5-16(13-17)18-11-12-29-30-15-18/h1-3,5-7,9,11-13,15,20,22,24,31H,4,8,10,14,28H2,(H,34,35)/t20-,22+,24?,27?/m0/s1 |
| InChIKey | NHSLVDNOALREDR-JNQSKHNJSA-N |
| XLogP | 3.45 |
| TPSA | 135.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.53 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|