About (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene
(3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene (PubChem CID 71140433) has the molecular formula C14H24O
and a molecular weight of 208.34 g/mol. Its IUPAC name is (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene.
Molecular Properties
| Compound Name | (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene |
| PubChem CID | 71140433 |
| Molecular Formula | C14H24O |
| Molecular Weight | 208.34 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene |
| SMILES | CC(C)=CCO[C@H]1C=C(C)CC(C)(C)C1 |
| InChI | InChI=1S/C14H24O/c1-11(2)6-7-15-13-8-12(3)9-14(4,5)10-13/h6,8,13H,7,9-10H2,1-5H3/t13-/m0/s1 |
| InChIKey | VGWALDHJERMOGS-ZDUSSCGKSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.34 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene?
The IUPAC name of (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene (CID 71140433) is (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene.
What is the SMILES notation for (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene?
The canonical SMILES for (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene is CC(C)=CCO[C@H]1C=C(C)CC(C)(C)C1.
What is the InChIKey of (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene?
The InChIKey is VGWALDHJERMOGS-ZDUSSCGKSA-N. The full InChI is InChI=1S/C14H24O/c1-11(2)6-7-15-13-8-12(3)9-14(4,5)10-13/h6,8,13H,7,9-10H2,1-5H3/t13-/m0/s1.
What are the key properties of (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene?
(3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene has a molecular weight of 208.34 g/mol, XLogP of 4.10, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-1,5,5-trimethyl-3-(3-methylbut-2-enoxy)cyclohexene is sourced from PubChem (CID 71140433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).