C12H23N3O2S — CID 71140889
5-methylsulfonyl-2-piperidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole (PubChem CID 71140889) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is 5-methylsulfonyl-2-piperidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole.
| Compound Name | 5-methylsulfonyl-2-piperidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
|---|---|
| PubChem CID | 71140889 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 5-methylsulfonyl-2-piperidin-4-yl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole |
| SMILES | CS(=O)(=O)N1CC2CN(C3CCNCC3)CC2C1 |
| InChI | InChI=1S/C12H23N3O2S/c1-18(16,17)15-8-10-6-14(7-11(10)9-15)12-2-4-13-5-3-12/h10-13H,2-9H2,1H3 |
| InChIKey | MVLMADFHKHQTPL-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |