C34H43N5O2 — CID 71140945
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-[1-[[pentyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]ethanone (PubChem CID 71140945) has the molecular formula C34H43N5O2 and a molecular weight of 553.75 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-[1-[[pentyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]ethanone.
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-[1-[[pentyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]ethanone |
|---|---|
| PubChem CID | 71140945 |
| Molecular Formula | C34H43N5O2 |
| Molecular Weight | 553.75 g/mol |
| Exact Mass | 553.34 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-[1-[[pentyl(5,6,7,8-tetrahydroquinolin-8-yl)amino]methyl]pyrido[3,4-b]indol-9-yl]ethanone |
| SMILES | CCCCCN(Cc1nccc2c3ccccc3n(CC(=O)N3C[C@@H](C)O[C@@H](C)C3)c12)C1CCCc2cccnc21 |
| InChI | InChI=1S/C34H43N5O2/c1-4-5-8-19-37(31-15-9-11-26-12-10-17-36-33(26)31)22-29-34-28(16-18-35-29)27-13-6-7-14-30(27)39(34)23-32(40)38-20-24(2)41-25(3)21-38/h6-7,10,12-14,16-18,24-25,31H,4-5,8-9,11,15,19-23H2,1-3H3/t24-,25+,31? |
| InChIKey | PYRZZQNPDIUWMP-WORPZTHTSA-N |
| XLogP | 6.29 |
| TPSA | 63.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.75 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|