C22H22ClF3N2O — CID 71141011
1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)butan-2-ol (PubChem CID 71141011) has the molecular formula C22H22ClF3N2O and a molecular weight of 422.88 g/mol. Its IUPAC name is 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)butan-2-ol.
| Compound Name | 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)butan-2-ol |
|---|---|
| PubChem CID | 71141011 |
| Molecular Formula | C22H22ClF3N2O |
| Molecular Weight | 422.88 g/mol |
| Exact Mass | 422.14 |
| IUPAC Name | 1-(8-chloro-2-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-5-yl)-3,3-difluoro-2-(4-fluorophenyl)butan-2-ol |
| SMILES | CN1CCc2c(c3cc(Cl)ccc3n2CC(O)(c2ccc(F)cc2)C(C)(F)F)C1 |
| InChI | InChI=1S/C22H22ClF3N2O/c1-21(25,26)22(29,14-3-6-16(24)7-4-14)13-28-19-8-5-15(23)11-17(19)18-12-27(2)10-9-20(18)28/h3-8,11,29H,9-10,12-13H2,1-2H3 |
| InChIKey | KEDGGKYICZJDTO-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 28.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.88 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|