C36H35FN4O7S — CID 71141279
(6S,9R,12S,15S)-12-benzyl-9-[(4-fluorophenyl)methyl]-4,7,10,13-tetraoxo-6-(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid (PubChem CID 71141279) has the molecular formula C36H35FN4O7S and a molecular weight of 686.76 g/mol. Its IUPAC name is (6S,9R,12S,15S)-12-benzyl-9-[(4-fluorophenyl)methyl]-4,7,10,13-tetraoxo-6-(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid.
| Compound Name | (6S,9R,12S,15S)-12-benzyl-9-[(4-fluorophenyl)methyl]-4,7,10,13-tetraoxo-6-(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
|---|---|
| PubChem CID | 71141279 |
| Molecular Formula | C36H35FN4O7S |
| Molecular Weight | 686.76 g/mol |
| Exact Mass | 686.22 |
| IUPAC Name | (6S,9R,12S,15S)-12-benzyl-9-[(4-fluorophenyl)methyl]-4,7,10,13-tetraoxo-6-(thiophen-2-ylmethyl)-2-oxa-5,8,11,14-tetrazabicyclo[15.2.2]henicosa-1(19),17,20-triene-15-carboxylic acid |
| SMILES | O=C1COc2ccc(cc2)C[C@@H](C(=O)O)NC(=O)[C@H](Cc2ccccc2)NC(=O)[C@@H](Cc2ccc(F)cc2)NC(=O)[C@H](Cc2cccs2)N1 |
| InChI | InChI=1S/C36H35FN4O7S/c37-25-12-8-23(9-13-25)18-29-33(43)39-28(17-22-5-2-1-3-6-22)34(44)41-31(36(46)47)19-24-10-14-26(15-11-24)48-21-32(42)38-30(35(45)40-29)20-27-7-4-16-49-27/h1-16,28-31H,17-21H2,(H,38,42)(H,39,43)(H,40,45)(H,41,44)(H,46,47)/t28-,29+,30-,31-/m0/s1 |
| InChIKey | KJFSHSRVOYTGBE-JVVMDBNWSA-N |
| XLogP | 2.57 |
| TPSA | 162.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.76 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'crown_ether', 'substructure': 'N/A'} |
|---|