About 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate
2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 71141596) has the molecular formula C15H16N2O5
and a molecular weight of 304.30 g/mol. Its IUPAC name is 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate.
Molecular Properties
| Compound Name | 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate |
| PubChem CID | 71141596 |
| Molecular Formula | C15H16N2O5 |
| Molecular Weight | 304.30 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate |
| SMILES | COC(=O)c1ccccc1C(=O)OCC1CN=C(C(C)=O)N1 |
| InChI | InChI=1S/C15H16N2O5/c1-9(18)13-16-7-10(17-13)8-22-15(20)12-6-4-3-5-11(12)14(19)21-2/h3-6,10H,7-8H2,1-2H3,(H,16,17) |
| InChIKey | HGBCULKYWDHBRV-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 94.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.30 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate?
The IUPAC name of 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate (CID 71141596) is 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate.
What is the SMILES notation for 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate?
The canonical SMILES for 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate is COC(=O)c1ccccc1C(=O)OCC1CN=C(C(C)=O)N1.
What is the InChIKey of 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate?
The InChIKey is HGBCULKYWDHBRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N2O5/c1-9(18)13-16-7-10(17-13)8-22-15(20)12-6-4-3-5-11(12)14(19)21-2/h3-6,10H,7-8H2,1-2H3,(H,16,17).
What are the key properties of 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate?
2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate has a molecular weight of 304.30 g/mol, XLogP of 0.59, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-[(2-acetyl-4,5-dihydro-1H-imidazol-5-yl)methyl] 1-O-methyl benzene-1,2-dicarboxylate is sourced from PubChem (CID 71141596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).