About 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium
5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium (PubChem CID 71141756) has the molecular formula C7H13IN+
and a molecular weight of 238.09 g/mol. Its IUPAC name is 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium.
Molecular Properties
| Compound Name | 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium |
| PubChem CID | 71141756 |
| Molecular Formula | C7H13IN+ |
| Molecular Weight | 238.09 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium |
| SMILES | C[N+]1(C)C=C(I)CCC1 |
| InChI | InChI=1S/C7H13IN/c1-9(2)5-3-4-7(8)6-9/h6H,3-5H2,1-2H3/q+1 |
| InChIKey | YWKVDZGHQOYZGH-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.09 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium?
The IUPAC name of 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium (CID 71141756) is 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium.
What is the SMILES notation for 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium?
The canonical SMILES for 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium is C[N+]1(C)C=C(I)CCC1.
What is the InChIKey of 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium?
The InChIKey is YWKVDZGHQOYZGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13IN/c1-9(2)5-3-4-7(8)6-9/h6H,3-5H2,1-2H3/q+1.
What are the key properties of 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium?
5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium has a molecular weight of 238.09 g/mol, XLogP of 2.13, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-iodo-1,1-dimethyl-3,4-dihydro-2H-pyridin-1-ium is sourced from PubChem (CID 71141756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).