About 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole
2,5-ditert-butyl-3,4-difluoro-1H-pyrrole (PubChem CID 71141817) has the molecular formula C12H19F2N
and a molecular weight of 215.29 g/mol. Its IUPAC name is 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole.
Molecular Properties
| Compound Name | 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole |
| PubChem CID | 71141817 |
| Molecular Formula | C12H19F2N |
| Molecular Weight | 215.29 g/mol |
| Exact Mass | 215.15 |
| IUPAC Name | 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole |
| SMILES | CC(C)(C)c1[nH]c(C(C)(C)C)c(F)c1F |
| InChI | InChI=1S/C12H19F2N/c1-11(2,3)9-7(13)8(14)10(15-9)12(4,5)6/h15H,1-6H3 |
| InChIKey | ZFHIHYHCYIPEAA-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.29 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole?
The IUPAC name of 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole (CID 71141817) is 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole.
What is the SMILES notation for 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole?
The canonical SMILES for 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole is CC(C)(C)c1[nH]c(C(C)(C)C)c(F)c1F.
What is the InChIKey of 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole?
The InChIKey is ZFHIHYHCYIPEAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19F2N/c1-11(2,3)9-7(13)8(14)10(15-9)12(4,5)6/h15H,1-6H3.
What are the key properties of 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole?
2,5-ditert-butyl-3,4-difluoro-1H-pyrrole has a molecular weight of 215.29 g/mol, XLogP of 3.89, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-ditert-butyl-3,4-difluoro-1H-pyrrole is sourced from PubChem (CID 71141817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).