C21H36F2O — CID 71142128
2-[difluoro-(3,4,5-trimethylcyclohexyl)oxymethyl]-1,3-dimethyl-5-[(E)-prop-1-enyl]cyclohexane (PubChem CID 71142128) has the molecular formula C21H36F2O and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-[difluoro-(3,4,5-trimethylcyclohexyl)oxymethyl]-1,3-dimethyl-5-[(E)-prop-1-enyl]cyclohexane.
| Compound Name | 2-[difluoro-(3,4,5-trimethylcyclohexyl)oxymethyl]-1,3-dimethyl-5-[(E)-prop-1-enyl]cyclohexane |
|---|---|
| PubChem CID | 71142128 |
| Molecular Formula | C21H36F2O |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.27 |
| IUPAC Name | 2-[difluoro-(3,4,5-trimethylcyclohexyl)oxymethyl]-1,3-dimethyl-5-[(E)-prop-1-enyl]cyclohexane |
| SMILES | C/C=C/C1CC(C)C(C(F)(F)OC2CC(C)C(C)C(C)C2)C(C)C1 |
| InChI | InChI=1S/C21H36F2O/c1-7-8-18-9-15(4)20(16(5)10-18)21(22,23)24-19-11-13(2)17(6)14(3)12-19/h7-8,13-20H,9-12H2,1-6H3/b8-7+ |
| InChIKey | TUNHQMOLSXKJOL-BQYQJAHWSA-N |
| XLogP | 6.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|