C36H40N8O3 — CID 71142491
tert-butyl N-[1-[4-[2-(2-amino-3-pyridinyl)-5-(4-morpholin-4-ylanilino)imidazo[4,5-b]pyridin-3-yl]phenyl]cyclobutyl]carbamate (PubChem CID 71142491) has the molecular formula C36H40N8O3 and a molecular weight of 632.77 g/mol. Its IUPAC name is tert-butyl N-[1-[4-[2-(2-amino-3-pyridinyl)-5-(4-morpholin-4-ylanilino)imidazo[4,5-b]pyridin-3-yl]phenyl]cyclobutyl]carbamate.
| Compound Name | tert-butyl N-[1-[4-[2-(2-amino-3-pyridinyl)-5-(4-morpholin-4-ylanilino)imidazo[4,5-b]pyridin-3-yl]phenyl]cyclobutyl]carbamate |
|---|---|
| PubChem CID | 71142491 |
| Molecular Formula | C36H40N8O3 |
| Molecular Weight | 632.77 g/mol |
| Exact Mass | 632.32 |
| IUPAC Name | tert-butyl N-[1-[4-[2-(2-amino-3-pyridinyl)-5-(4-morpholin-4-ylanilino)imidazo[4,5-b]pyridin-3-yl]phenyl]cyclobutyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(c2ccc(-n3c(-c4cccnc4N)nc4ccc(Nc5ccc(N6CCOCC6)cc5)nc43)cc2)CCC1 |
| InChI | InChI=1S/C36H40N8O3/c1-35(2,3)47-34(45)42-36(17-5-18-36)24-7-11-27(12-8-24)44-32(28-6-4-19-38-31(28)37)40-29-15-16-30(41-33(29)44)39-25-9-13-26(14-10-25)43-20-22-46-23-21-43/h4,6-16,19H,5,17-18,20-23H2,1-3H3,(H2,37,38)(H,39,41)(H,42,45) |
| InChIKey | REGLNFYFZFYPTD-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 132.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.77 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|