C10H16O4 — CID 71142535
(3aS,6S)-6-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one (PubChem CID 71142535) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (3aS,6S)-6-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one.
| Compound Name | (3aS,6S)-6-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
|---|---|
| PubChem CID | 71142535 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (3aS,6S)-6-(methoxymethyl)-2,2-dimethyl-3a,5,6,6a-tetrahydrocyclopenta[d][1,3]dioxol-4-one |
| SMILES | COC[C@@H]1CC(=O)[C@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H16O4/c1-10(2)13-8-6(5-12-3)4-7(11)9(8)14-10/h6,8-9H,4-5H2,1-3H3/t6-,8?,9+/m0/s1 |
| InChIKey | LIZZLHCTZNKZJI-WGQGIHMKSA-N |
| XLogP | 0.74 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |