C18H15Cl2NO6 — CID 71142790
1-[(2S,3S,4S)-3,6-dichloro-4-hydroxy-2-(4-methylphenyl)-3-nitro-2,4-dihydrochromen-8-yl]-2-hydroxyethanone (PubChem CID 71142790) has the molecular formula C18H15Cl2NO6 and a molecular weight of 412.23 g/mol. Its IUPAC name is 1-[(2S,3S,4S)-3,6-dichloro-4-hydroxy-2-(4-methylphenyl)-3-nitro-2,4-dihydrochromen-8-yl]-2-hydroxyethanone.
| Compound Name | 1-[(2S,3S,4S)-3,6-dichloro-4-hydroxy-2-(4-methylphenyl)-3-nitro-2,4-dihydrochromen-8-yl]-2-hydroxyethanone |
|---|---|
| PubChem CID | 71142790 |
| Molecular Formula | C18H15Cl2NO6 |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 1-[(2S,3S,4S)-3,6-dichloro-4-hydroxy-2-(4-methylphenyl)-3-nitro-2,4-dihydrochromen-8-yl]-2-hydroxyethanone |
| SMILES | Cc1ccc([C@@H]2Oc3c(C(=O)CO)cc(Cl)cc3[C@H](O)[C@@]2(Cl)[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H15Cl2NO6/c1-9-2-4-10(5-3-9)17-18(20,21(25)26)16(24)13-7-11(19)6-12(14(23)8-22)15(13)27-17/h2-7,16-17,22,24H,8H2,1H3/t16-,17-,18+/m0/s1 |
| InChIKey | DMTJCODZFRBNSF-OKZBNKHCSA-N |
| XLogP | 3.20 |
| TPSA | 109.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|