C15H29FO4Si — CID 71143021
2-[[(6R,8S,8aS)-7-fluoro-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane (PubChem CID 71143021) has the molecular formula C15H29FO4Si and a molecular weight of 320.48 g/mol. Its IUPAC name is 2-[[(6R,8S,8aS)-7-fluoro-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(6R,8S,8aS)-7-fluoro-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 71143021 |
| Molecular Formula | C15H29FO4Si |
| Molecular Weight | 320.48 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | 2-[[(6R,8S,8aS)-7-fluoro-2,2,8-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane |
| SMILES | C[C@@H]1C(F)[C@H](OCC[Si](C)(C)C)OC2COC(C)(C)O[C@H]21 |
| InChI | InChI=1S/C15H29FO4Si/c1-10-12(16)14(17-7-8-21(4,5)6)19-11-9-18-15(2,3)20-13(10)11/h10-14H,7-9H2,1-6H3/t10-,11?,12?,13+,14-/m1/s1 |
| InChIKey | BPFHWMBXDGLXBN-UUFIZFKYSA-N |
| XLogP | 3.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|