C19H20ClN3 — CID 71143204
3-(4-chlorophenyl)-N-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]propan-1-amine (PubChem CID 71143204) has the molecular formula C19H20ClN3 and a molecular weight of 325.84 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]propan-1-amine.
| Compound Name | 3-(4-chlorophenyl)-N-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]propan-1-amine |
|---|---|
| PubChem CID | 71143204 |
| Molecular Formula | C19H20ClN3 |
| Molecular Weight | 325.84 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | 3-(4-chlorophenyl)-N-methyl-2-[4-(1H-pyrazol-4-yl)phenyl]propan-1-amine |
| SMILES | CNCC(Cc1ccc(Cl)cc1)c1ccc(-c2cn[nH]c2)cc1 |
| InChI | InChI=1S/C19H20ClN3/c1-21-11-17(10-14-2-8-19(20)9-3-14)15-4-6-16(7-5-15)18-12-22-23-13-18/h2-9,12-13,17,21H,10-11H2,1H3,(H,22,23) |
| InChIKey | KSVZAUKORKANNR-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.84 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |