C18H35FO6Si — CID 71143369
2-[[(4aR,6R,8S,8aS)-8-(2-ethoxyethoxy)-7-fluoro-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane (PubChem CID 71143369) has the molecular formula C18H35FO6Si and a molecular weight of 394.56 g/mol. Its IUPAC name is 2-[[(4aR,6R,8S,8aS)-8-(2-ethoxyethoxy)-7-fluoro-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane.
| Compound Name | 2-[[(4aR,6R,8S,8aS)-8-(2-ethoxyethoxy)-7-fluoro-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane |
|---|---|
| PubChem CID | 71143369 |
| Molecular Formula | C18H35FO6Si |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 2-[[(4aR,6R,8S,8aS)-8-(2-ethoxyethoxy)-7-fluoro-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-6-yl]oxy]ethyl-trimethylsilane |
| SMILES | CCOCCO[C@@H]1C(F)[C@H](OCC[Si](C)(C)C)O[C@@H]2COC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H35FO6Si/c1-7-20-8-9-21-16-14(19)17(22-10-11-26(4,5)6)24-13-12-23-18(2,3)25-15(13)16/h13-17H,7-12H2,1-6H3/t13-,14?,15+,16-,17-/m1/s1 |
| InChIKey | XELLANKLCDDRGV-DLWDUGJOSA-N |
| XLogP | 2.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|