C49H44ClN5O5S — CID 71143607
tert-butyl 4-[4-[7-(4-chloro-3-oxo-1H-isoindol-2-yl)-5-tritylpyrrolo[2,3-b]pyrazin-2-yl]phenyl]sulfonylpiperidine-1-carboxylate (PubChem CID 71143607) has the molecular formula C49H44ClN5O5S and a molecular weight of 850.44 g/mol. Its IUPAC name is tert-butyl 4-[4-[7-(4-chloro-3-oxo-1H-isoindol-2-yl)-5-tritylpyrrolo[2,3-b]pyrazin-2-yl]phenyl]sulfonylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[4-[7-(4-chloro-3-oxo-1H-isoindol-2-yl)-5-tritylpyrrolo[2,3-b]pyrazin-2-yl]phenyl]sulfonylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 71143607 |
| Molecular Formula | C49H44ClN5O5S |
| Molecular Weight | 850.44 g/mol |
| Exact Mass | 849.28 |
| IUPAC Name | tert-butyl 4-[4-[7-(4-chloro-3-oxo-1H-isoindol-2-yl)-5-tritylpyrrolo[2,3-b]pyrazin-2-yl]phenyl]sulfonylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(S(=O)(=O)c2ccc(-c3cnc4c(n3)c(N3Cc5cccc(Cl)c5C3=O)cn4C(c3ccccc3)(c3ccccc3)c3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C49H44ClN5O5S/c1-48(2,3)60-47(57)53-28-26-39(27-29-53)61(58,59)38-24-22-33(23-25-38)41-30-51-45-44(52-41)42(54-31-34-14-13-21-40(50)43(34)46(54)56)32-55(45)49(35-15-7-4-8-16-35,36-17-9-5-10-18-36)37-19-11-6-12-20-37/h4-25,30,32,39H,26-29,31H2,1-3H3 |
| InChIKey | GHBVOYWFZQUCRJ-UHFFFAOYSA-N |
| XLogP | 9.93 |
| TPSA | 114.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 850.44 |
| LogP ≤ 5 | 9.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|