About 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol
2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol (PubChem CID 71143790) has the molecular formula C15H11F4N5O
and a molecular weight of 353.28 g/mol. Its IUPAC name is 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol.
Molecular Properties
| Compound Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol |
| PubChem CID | 71143790 |
| Molecular Formula | C15H11F4N5O |
| Molecular Weight | 353.28 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol |
| SMILES | OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccccn1 |
| InChI | InChI=1S/C15H11F4N5O/c16-10-4-5-11(12(17)7-10)14(25,8-24-9-21-22-23-24)15(18,19)13-3-1-2-6-20-13/h1-7,9,25H,8H2 |
| InChIKey | QJSIDAFXZGMWSO-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 353.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol?
The IUPAC name of 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol (CID 71143790) is 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol.
What is the SMILES notation for 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol?
The canonical SMILES for 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol is OC(Cn1cnnn1)(c1ccc(F)cc1F)C(F)(F)c1ccccn1.
What is the InChIKey of 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol?
The InChIKey is QJSIDAFXZGMWSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11F4N5O/c16-10-4-5-11(12(17)7-10)14(25,8-24-9-21-22-23-24)15(18,19)13-3-1-2-6-20-13/h1-7,9,25H,8H2.
What are the key properties of 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol?
2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol has a molecular weight of 353.28 g/mol, XLogP of 2.03, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,4-difluorophenyl)-1,1-difluoro-1-pyridin-2-yl-3-(tetrazol-1-yl)propan-2-ol is sourced from PubChem (CID 71143790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).