C21H13F2NO3 — CID 71145080
16,18-difluoro-5,11-dimethoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene (PubChem CID 71145080) has the molecular formula C21H13F2NO3 and a molecular weight of 365.34 g/mol. Its IUPAC name is 16,18-difluoro-5,11-dimethoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene.
| Compound Name | 16,18-difluoro-5,11-dimethoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 71145080 |
| Molecular Formula | C21H13F2NO3 |
| Molecular Weight | 365.34 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | 16,18-difluoro-5,11-dimethoxy-8-oxa-20-azapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2(7),3,5,9,11,13,15,17,19-decaene |
| SMILES | COc1ccc2c(c1)Oc1cc(OC)cc3c1c-2nc1c(F)cc(F)cc13 |
| InChI | InChI=1S/C21H13F2NO3/c1-25-11-3-4-13-17(8-11)27-18-9-12(26-2)7-14-15-5-10(22)6-16(23)20(15)24-21(13)19(14)18/h3-9H,1-2H3 |
| InChIKey | SIQBZGMBVFVXFJ-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.34 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|