C24H16NOS+ — CID 71145491
20-methyl-16-thiophen-3-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene (PubChem CID 71145491) has the molecular formula C24H16NOS+ and a molecular weight of 366.47 g/mol. Its IUPAC name is 20-methyl-16-thiophen-3-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene.
| Compound Name | 20-methyl-16-thiophen-3-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene |
|---|---|
| PubChem CID | 71145491 |
| Molecular Formula | C24H16NOS+ |
| Molecular Weight | 366.47 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | 20-methyl-16-thiophen-3-yl-8-oxa-20-azoniapentacyclo[11.7.1.02,7.09,21.014,19]henicosa-1(21),2,4,6,9,11,13,15,17,19-decaene |
| SMILES | C[n+]1c2c3c(cccc3c3cc(-c4ccsc4)ccc31)Oc1ccccc1-2 |
| InChI | InChI=1S/C24H16NOS/c1-25-20-10-9-15(16-11-12-27-14-16)13-19(20)17-6-4-8-22-23(17)24(25)18-5-2-3-7-21(18)26-22/h2-14H,1H3/q+1 |
| InChIKey | WLMLWISIDBDGKQ-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.47 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|