C20H23ClO3 — CID 71145705
(3,3-dimethyl-1-phenylmethoxybutan-2-yl) 3-chlorobenzoate (PubChem CID 71145705) has the molecular formula C20H23ClO3 and a molecular weight of 346.85 g/mol. Its IUPAC name is (3,3-dimethyl-1-phenylmethoxybutan-2-yl) 3-chlorobenzoate.
| Compound Name | (3,3-dimethyl-1-phenylmethoxybutan-2-yl) 3-chlorobenzoate |
|---|---|
| PubChem CID | 71145705 |
| Molecular Formula | C20H23ClO3 |
| Molecular Weight | 346.85 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | (3,3-dimethyl-1-phenylmethoxybutan-2-yl) 3-chlorobenzoate |
| SMILES | CC(C)(C)C(COCc1ccccc1)OC(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C20H23ClO3/c1-20(2,3)18(14-23-13-15-8-5-4-6-9-15)24-19(22)16-10-7-11-17(21)12-16/h4-12,18H,13-14H2,1-3H3 |
| InChIKey | BLPQNEPFCMXYND-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.85 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |